Iniparib
Catalog No: FT-0670350
CAS No: 160003-66-7
- Chemical Name: Iniparib
- Molecular Formula: C7H5IN2O3
- Molecular Weight: 292.03
- InChI Key: MDOJTZQKHMAPBK-UHFFFAOYSA-N
- InChI: InChI=1S/C7H5IN2O3/c8-5-2-1-4(7(9)11)3-6(5)10(12)13/h1-3H,(H2,9,11)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 292.031 |
| Density: | 2.1±0.1 g/cm3 |
| CAS: | 160003-66-7 |
| Bolling_Point: | 344.8±32.0 °C at 760 mmHg |
| Product_Name: | Iniparib (BSI-201) |
| Melting_Point: | N/A |
| Flash_Point: | 162.3±25.1 °C |
| MF: | C7H5IN2O3 |
| Density: | 2.1±0.1 g/cm3 |
|---|---|
| LogP: | 1.71 |
| Flash_Point: | 162.3±25.1 °C |
| Refractive_Index: | 1.696 |
| FW: | 292.031 |
| PSA: | 88.91000 |
| MF: | C7H5IN2O3 |
| Bolling_Point: | 344.8±32.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.8 mmHg at 25°C |
| Exact_Mass: | 291.934479 |
| Warning_Statement: | P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H302-H319 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2924299090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)